InCHi String:
InChI=1S/C8H11NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,10-12H,3-4H2,1H3
canonical SMILES: CC1=NC=C(C(=C1O)CO)CO
IUPAC: IUPAC openeye: IUPAC cas: IUPAC systematic4,5-bis(hydroxymethyl)-2-methyl-pyridin-3-ol
IUPAC traditional2-methyl-4,5-dimethylol-pyridin-3-ol
PubChem Substance (SID):
85165092 149073 3608PubChem Compound (CID):
1054KEGG: Compound ID
C00314CAS Registry IDs: 65-23-6 58-56-0
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChemIDplus 000065236
EINECS 200-603-0
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.