InCHi String:
InChI=1S/2C8H6O3/c9-7-5-3-1-2-4-6(5)8(10)11-7;9-5-6-3-1-2-4-7(6)8(10)11/h1-4,7,9H;1-5H,(H,10,11)
canonical and isomeric SMILES: C1=CC=C(C(=C1)C=O)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME2-formylbenzoic acid
PUBCHEM iupac TRADITIONAL NAMEphthalaldehydic acid
PUBCHEM iupac SYSTEMATIC NAME2-methanoylbenzoic acid
PubChem Substance (SID):
85165252 24847258 40715254PubChem Compound (CID):
16211212KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 116017_ALDRICH
ChemSpider 17339253
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.