InCHi String:
InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/t7-/m0/s1
canonical SMILES: CC(C)(CO)C(C(=O)NCCC(=O)O)O
IUPAC: IUPAC traditional: IUPAC openeye: IUPAC systematic3-[[(2S)-2,4-dihydroxy-3,3-dimethyl-butanoyl]amino]propanoic acid
IUPAC cas3-[[(2S)-2,4-dihydroxy-3,3-dimethyl-1-oxo-butyl]amino]propanoic acid
PubChem Substance (SID):
85165091 149588 4121PubChem Compound (CID):
6613KEGG: Compound ID
C00864CAS Registry IDs: 79-83-4 3563-85-7
PDB Chemical Component
PAUMiscellaneous Databases and IDs:
ChemIDplus 000079834
EINECS 201-229-0
HSDB 1020
Beilstein Handbook Reference 4-04-00-02569
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
