InCHi String:
InChI=1S/C6H6O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2H,1H2,(H,7,8)(H,10,11)(H,12,13)
canonical SMILES: C(C(C(=O)C(=O)O)C(=O)O)C(=O)O
IUPAC: IUPAC traditional: IUPAC openeye: IUPAC cas: IUPAC systematic1-oxopropane-1,2,3-tricarboxylic acid
PubChem Substance (SID):
85165058 7753PubChem Compound (CID):
972KEGG: Compound ID
C05379CAS Registry IDs: 1948-82-9
PDB Chemical Component
OXSMiscellaneous Databases and IDs:
ChemIDplus *na
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
