InCHi String:
InChI=1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11)
canonical SMILES: C1=C(NC(=O)NC1=O)C(=O)O
IUPAC: IUPAC traditional: IUPAC openeye: IUPAC cas: IUPAC systematic2,6-dioxo-3H-pyrimidine-4-carboxylic acid
PubChem Substance (SID):
85165087 149086 3589PubChem Compound (CID):
967KEGG: Compound ID
C00295CAS Registry IDs: 65-86-1 6784-70-9
PDB Chemical Component
OROMiscellaneous Databases and IDs:
ChemIDplus 000065861
EINECS 200-619-8
CCRIS 3929
HSDB 6377
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
