InCHi String:
InChI=1S/C8H13NO6/c9-5(8(13)14)3-4-15-7(12)2-1-6(10)11/h5H,1-4,9H2,(H,10,11)(H,13,14)/t5-/m0/s1
isomeric SMILES: C(COC(=O)CCC(=O)O)[C@@H](C(=O)O)N
canonical SMILES: C(COC(=O)CCC(=O)O)C(C(=O)O)N
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic4-[(3S)-3-amino-3-carboxy-propoxy]-4-oxo-butanoic acid
PubChem Substance (SID):
85164906 4349PubChem Compound (CID):
439406KEGG: Compound ID
C01118CAS Registry IDs: 1492-23-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 16160
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.