InCHi String:
InChI=1S/C6H6N2O/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9)
canonical SMILES: C1=CC(=CN=C1)C(=O)N
IUPAC: IUPAC openeye: IUPAC cas: IUPAC systematicpyridine-3-carboxamide
IUPAC traditionalnicotinamide
PubChem Substance (SID):
85165085 150480 3453PubChem Compound (CID):
936KEGG: Compound ID
C00153CAS Registry IDs: 37321-14-5 123574-63-0 78731-47-2 98-92-0
PDB Chemical Component
NCAMiscellaneous Databases and IDs:
ChemIDplus 000098920
EINECS 202-713-4
CCRIS 1901
HSDB 1237
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
