InCHi String:
InChI=1S/C5H9NO4/c1-6-3(5(9)10)2-4(7)8/h3,6H,2H2,1H3,(H,7,8)(H,9,10)/t3-/m0/s1
canonical SMILES: CNC(CC(=O)O)C(=O)O
isomeric SMILES: CN[C@@H](CC(=O)O)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME: PUBCHEM iupac SYSTEMATIC NAME(2S)-2-(methylamino)butanedioic acid
PUBCHEM iupac TRADITIONAL NAME(2S)-2-(methylamino)succinic acid
PubChem Substance (SID):
111677872 669920 56458805PubChem Compound (CID):
92982KEGG: Compound ID n/a
CAS Registry IDs: 4226-18-0
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich M3387_SIGMA
ChemIDplus 004226180
MMCD cq_08818
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.