InCHi String:
InChI=1S/C6H10N2O5/c7-6(13)8-3(5(11)12)1-2-4(9)10/h3H,1-2H2,(H,9,10)(H,11,12)(H3,7,8,13)
canonical and isomeric SMILES: C(CC(=O)O)C(C(=O)O)NC(=O)N
PUBCHEM iupac NAME2-(carbamoylamino)pentanedioic acid
PUBCHEM iupac TRADITIONAL NAME2-ureidoglutaric acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME2-ureidopentanedioic acid
PUBCHEM iupac SYSTEMATIC NAME2-(aminocarbonylamino)pentanedioic acid
PubChem Substance (SID):
85165170 17390933 40201484PubChem Compound (CID):
3679006KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich C4375_SIGMA
ChemSpider 2911647
ChemDB 3999136
MMCD cq_03273
MDL MFCD00047874
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.