InCHi String:
InChI=1S/C8H16N2O3/c1-6(11)10-7(8(12)13)4-2-3-5-9/h7H,2-5,9H2,1H3,(H,10,11)(H,12,13)/t7-/m0/s1
canonical SMILES: CC(=O)NC(CCCCN)C(=O)O
isomeric SMILES: CC(=O)N[C@@H](CCCCN)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME(2S)-2-acetamido-6-aminohexanoic acid
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME(2S)-2-acetamido-6-amino-hexanoic acid
PUBCHEM iupac SYSTEMATIC NAME(2S)-2-acetamido-6-azanyl-hexanoic acid
PubChem Substance (SID):
126596870 24890614 669837PubChem Compound (CID):
92907KEGG: Compound ID n/a
CAS Registry IDs: 1946-82-3
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 1946-82-3
MDL number MFCD00008233
MMCD cq_09310
EC Number 217-747-5
Sigma-Aldrich A2010_SIGMA
ChEBI CHEBI:35704 EINECS 217-747-5
ChemIDplus 001946823
TCI (Tokyo Chemical Industry) A2171
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.