InCHi String:
InChI=1S/C8H16NO9P/c1-3(10)9-5-7(12)6(11)4(18-8(5)13)2-17-19(14,15)16/h4-8,11-13H,2H2,1H3,(H,9,10)(H2,14,15,16)/p-2/t4-,5-,6-,7-,8?/m1/s1
isomeric and canonical SMILES: CC(=O)NC1C(C(C(OC1O)COP(=O)(O)O)O)O
IUPAC: IUPAC systematic(5-acetamido-3,4,6-trihydroxy-oxan-2-yl)methoxyphosphonic acid
IUPAC traditional: IUPAC cas: IUPAC openeye(5-acetamido-3,4,6-trihydroxy-tetrahydropyran-2-yl)methoxyphosphonic acid
PubChem Substance (SID):
111677733 2965PubChem Compound (CID):
898KEGG: Compound ID n/a
CAS Registry IDs: 102029-88-9
PDB Chemical Component
0AT 16GMiscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.