InCHi String:
InChI=1S/C8H9NO4/c1-12-7(10)5-9-8(11)6-3-2-4-13-6/h2-4H,5H2,1H3,(H,9,11)
canonical and isomeric SMILES: COC(=O)CNC(=O)C1=CC=CO1
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAMEmethyl 2-(furan-2-carbonylamino)acetate
PUBCHEM iupac TRADITIONAL NAME2-(2-furoylamino)acetic acid methyl ester
PUBCHEM iupac CAS NAME2-[[2-furyl(oxo)methyl]amino]acetic acid methyl ester
PUBCHEM iupac SYSTEMATIC NAMEmethyl 2-(furan-2-ylcarbonylamino)ethanoate
PubChem Substance (SID):
111677855 24865491 10506750PubChem Compound (CID):
518748KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 407860_ALDRICH
ZINC ZINC00155095
NIST Chemistry WebBook 1194996627
MDL MFCD00192187
CAS 13290-00-1
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.