InCHi String:
InChI=1S/C4H5NO3/c5-3(6)1-2-4(7)8/h1-2H,(H2,5,6)(H,7,8)/b2-1-
canonical SMILES: C(=CC(=O)O)C(=O)N
isomeric SMILES: C(=C/C(=O)O)/C(=O)N
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME(Z)-4-amino-4-oxobut-2-enoic acid
PUBCHEM iupac TRADITIONAL NAME(Z)-4-amino-4-keto-but-2-enoic acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME(Z)-4-amino-4-oxo-but-2-enoic acid
PubChem Substance (SID):
85165247 4751 24868186PubChem Compound (CID):
5280451KEGG: Compound ID
C01596CAS Registry IDs: 557-24-4
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 445495_ALDRICH
ChEBI CHEBI:29045 ChemSpider 4444106
BIND 601
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.