InCHi String:
InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1
isomeric SMILES: CC(C)[C@@H](C(=O)O)N
canonical SMILES: CC(C)C(C(=O)O)N
IUPAC(2S)-2-amino-3-methyl-butanoic acid
PubChem Substance (SID):
85164900 149225 3483PubChem Compound (CID):
6287KEGG: Compound ID
C00183CAS Registry IDs: 16872-32-5 7004-03-7 72-18-4
PDB Chemical Component
VAL VAL_LFOHMiscellaneous Databases and IDs:
CHEBI 16414 EINECS 200-773-6
NSC 76038
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
