InCHi String:
InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1
isomeric SMILES: C[C@H]([C@@H](C(=O)O)N)O
canonical SMILES: CC(C(C(=O)O)N)O
IUPAC(2S,3R)-2-amino-3-hydroxy-butanoic acid
PubChem Substance (SID):
85164897 149226 3488PubChem Compound (CID):
6288KEGG: Compound ID
C00188CAS Registry IDs: 13095-55-1 36676-50-3 72-19-5
PDB Chemical Component
THR THR_LFOH THR_LFZWMiscellaneous Databases and IDs:
CHEBI 16857 NSC 16589
EINECS 200-774-1
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
