InCHi String:
InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2
isomeric and canonical SMILES: C(C(C(CO)O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematicbutane-1,2,3,4-tetrol
PubChem Substance (SID):
111677725 272831PubChem Compound (CID):
8998KEGG: Compound ID n/a
CAS Registry IDs: 2319-57-5
PDB Chemical Component
DTL MRYMiscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
