InCHi String:
InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)
isomeric and canonical SMILES: C(C(C(=O)O)O)(C(=O)O)O
IUPAC: IUPAC systematic2,3-dihydroxybutanedioic acid
IUPAC traditional: IUPAC cas: IUPAC openeyetartaric acid
PubChem Substance (SID):
85164990 149907 4154PubChem Compound (CID):
875KEGG: Compound ID
C00898CAS Registry IDs: 1336-18-1 8014-54-8 8059-77-6 87-69-4
PDB Chemical Component
SRT TAR TLAMiscellaneous Databases and IDs:
CHEBI 15671 EINECS 201-766-0
NSC 62778
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
