InCHi String:
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1
isomeric SMILES: C([C@@H](C(=O)O)N)O
canonical SMILES: C(C(C(=O)O)N)O
IUPAC(2S)-2-amino-3-hydroxy-propanoic acid
PubChem Substance (SID):
85164896 148777 3365PubChem Compound (CID):
5951KEGG: Compound ID
C00065CAS Registry IDs: 56-45-1 6898-95-9
PDB Chemical Component
SER SER_LFOH SER_LFZWMiscellaneous Databases and IDs:
CHEBI 17115 EINECS 200-274-3
HSDB 680
Beilstein Handbook Reference 4-04-00-03118
NSC 118365
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
