InCHi String:
InChI=1S/C5H11NO2Se/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1
isomeric SMILES: C[Se]CC[C@@H](C(=O)O)N
canonical SMILES: C[Se]CCC(C(=O)O)N
IUPAC(2S)-2-amino-4-methylselanyl-butanoic acid
IUPAC traditional: IUPAC cas(2S)-2-amino-4-methylseleno-butanoic acid
PubChem Substance (SID):
85164992 682499PubChem Compound (CID):
105024KEGG: Compound ID n/a
CAS Registry IDs: 3211-76-5
PDB Chemical Component
MSEMiscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.