InCHi String:
InChI=1S/C6H13NO2S.HI/c1-10(2)4-3-5(7)6(8)9;/h5H,3-4,7H2,1-2H3;1H
isomeric and canonical SMILES: C[S+](C)CCC(C(=O)O)N.[I-]
IUPAC: IUPAC systematic(3-amino-3-carboxy-propyl)-dimethyl-sulfanium iodide
IUPAC traditional: IUPAC cas: IUPAC openeye(3-amino-3-carboxy-propyl)-dimethyl-sulfonium iodide
PubChem Substance (SID):
85164979 3886671PubChem Compound (CID):
200814KEGG: Compound ID n/a
CAS Registry IDs: 34236-06-1
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
EINECS 251-893-0
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.