InCHi String:
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1
isomeric SMILES: CSCC[C@@H](C(=O)O)N
canonical SMILES: CSCCC(C(=O)O)N
IUPAC(2S)-2-amino-4-methylsulfanyl-butanoic acid
PubChem Substance (SID):
85164892 149032 3373PubChem Compound (CID):
6137KEGG: Compound ID
C00073CAS Registry IDs: 24425-78-3 63-68-3 7005-18-7
PDB Chemical Component
MET MET_LFOHMiscellaneous Databases and IDs:
CHEBI 16643 NSC 22946
EINECS 200-562-9
CCRIS 5536
HSDB 4317
CCRIS 5528
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
