InCHi String:
InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1
isomeric SMILES: C(CCN)C[C@@H](C(=O)O)N
canonical SMILES: C(CCN)CC(C(=O)O)N
IUPAC(2S)-2,6-diaminohexanoic acid
PubChem Substance (SID):
85164891 148795 3349PubChem Compound (CID):
5962KEGG: Compound ID
C00047CAS Registry IDs: 280114-50-3 48050-57-3 56-87-1 57282-49-2 657-27-2 6899-06-5
PDB Chemical Component
DLY LYS LYS_LFOHMiscellaneous Databases and IDs:
CHEBI 18019 Beilstein Handbook Reference 4-04-00-02717
HSDB 2108
EINECS 200-294-2
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.