InCHi String:
InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1
isomeric SMILES: CC(C)C[C@@H](C(=O)O)N
canonical SMILES: CC(C)CC(C(=O)O)N
IUPAC(2S)-2-amino-4-methyl-pentanoic acid
PubChem Substance (SID):
85164890 148996 3423PubChem Compound (CID):
6106KEGG: Compound ID
C00123CAS Registry IDs: 61-90-5 7005-03-0
PDB Chemical Component
LEU LEU_LFOH LEU_LFZWMiscellaneous Databases and IDs:
CHEBI 15603 FEMA No. 3297
NSC 46709
EINECS 200-522-0
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.