InCHi String:
InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15)/t8-/m0/s1
isomeric SMILES: C1=CC=C(C(=C1)C(=O)C[C@@H](C(=O)O)N)N
canonical SMILES: C1=CC=C(C(=C1)C(=O)CC(C(=O)O)N)N
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic(2S)-2-amino-4-(2-aminophenyl)-4-oxo-butanoic acid
PubChem Substance (SID):
85164995 746480 3622PubChem Compound (CID):
161166KEGG: Compound ID
C00328CAS Registry IDs: 2922-83-0
PDB Chemical Component
KYNMiscellaneous Databases and IDs:
CHEBI 16946 CCRIS 4425
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.