InCHi String:
InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1
isomeric SMILES: CC[C@H](C)[C@@H](C(=O)O)N
canonical SMILES: CCC(C)C(C(=O)O)N
IUPAC(2S,3S)-2-amino-3-methyl-pentanoic acid
PubChem Substance (SID):
85164889 149247 3697PubChem Compound (CID):
6306KEGG: Compound ID
C00407CAS Registry IDs: 7004-09-3 73-32-5
PDB Chemical Component
ILE ILE_LFOH ILE_LFZWMiscellaneous Databases and IDs:
CHEBI 17191 NSC 46708
CCRIS 5229
EINECS 200-798-2
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.