InCHi String:
InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1
isomeric SMILES: C(CO)[C@@H](C(=O)O)N
canonical SMILES: C(CO)C(C(=O)O)N
IUPAC(2S)-2-amino-4-hydroxy-butanoic acid
PubChem Substance (SID):
85164888 155978 3561PubChem Compound (CID):
12647KEGG: Compound ID
C00263CAS Registry IDs: 498-19-1 672-15-1
PDB Chemical Component
HSEMiscellaneous Databases and IDs:
CHEBI 15699 NSC 206251
EINECS 211-590-6
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.