InCHi String:
InChI=1S/C7H15N3O3/c8-5(6(11)12)3-1-2-4-10-7(9)13/h5H,1-4,8H2,(H,11,12)(H3,9,10,13)/t5-/m0/s1
canonical SMILES: C(CCNC(=O)N)CC(C(=O)O)N
isomeric SMILES: C(CCNC(=O)N)C[C@@H](C(=O)O)N
PUBCHEM iupac NAME(2S)-2-amino-6-(carbamoylamino)hexanoic acid
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME(2S)-2-amino-6-ureido-hexanoic acid
PUBCHEM iupac CAS NAME(2S)-2-amino-6-ureidohexanoic acid
PUBCHEM iupac SYSTEMATIC NAME(2S)-2-amino-6-(aminocarbonylamino)hexanoic acid
PubChem Substance (SID):
85165231 207029 43121912PubChem Compound (CID):
65072KEGG: Compound ID
C02427CAS Registry IDs: 1190-49-4
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChEBI CHEBI:17443 ChemIDplus 001190494
ChemSpider 58582
EINECS 214-722-0
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.