bmse000039 L-Histidine at BMRB

InCHi String:
InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1

isomeric SMILES:
C1=C(NC=N1)C[C@@H](C(=O)O)N
canonical SMILES:
C1=C(NC=N1)CC(C(=O)O)N

IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic
(2S)-2-amino-3-(3H-imidazol-4-yl)propanoic acid

PubChem Substance (SID):   85164887   149204   3435
PubChem Compound (CID):   6274
KEGG: Compound ID   C00135
CAS Registry IDs:   150-35-6   155304-24-8   35479-49-3   35558-59-9   45955-20-2   54166-13-1   7006-35-1   71-00-1
PDB Chemical Component   HIS   HIS_LFOH
Miscellaneous Databases and IDs:   CHEBI 15971   FEMA No. 3694   EINECS 200-745-3   NSC 137773   HSDB 1810

Reference data were obtained primarily from the PubChem database.

Three dimensional molecular rendering uses Jmol.