InCHi String:
InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3+,4+,5-,6?/m0/s1
isomeric SMILES: C[C@H]1[C@H]([C@H]([C@@H](C(O1)O)O)O)O
canonical SMILES: CC1C(C(C(C(O1)O)O)O)O
IUPAC(3S,4R,5R,6S)-6-methyloxane-2,3,4,5-tetrol
IUPAC traditional: IUPAC cas: IUPAC openeye(3S,4R,5R,6S)-6-methyltetrahydropyran-2,3,4,5-tetrol
PubChem Substance (SID):
85164884 160301 4264PubChem Compound (CID):
17106KEGG: Compound ID
C01019CAS Registry IDs: 2438-80-4
PDB Chemical Component
AFL FUC FUL INSMiscellaneous Databases and IDs:
CHEBI 18287 EINECS 219-452-7
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.