InCHi String:
InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1
isomeric SMILES: C([C@@H](C(=O)O)N)SSC[C@@H](C(=O)O)N
canonical SMILES: C(C(C(=O)O)N)SSCC(C(=O)O)N
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic(2R)-2-amino-3-[(2R)-2-amino-2-carboxy-ethyl]disulfanyl-propanoic acid
PubChem Substance (SID):
85164883 209796 3774PubChem Compound (CID):
67678KEGG: Compound ID
C00491CAS Registry IDs: 349-46-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 16283 EINECS 206-486-2
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
