InCHi String:
InChI=1S/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1
isomeric SMILES: C(CSC[C@H](C(=O)O)N)[C@@H](C(=O)O)N
canonical SMILES: C(CSCC(C(=O)O)N)C(C(=O)O)N
IUPAC: IUPAC openeye: IUPAC systematic(2S)-2-amino-4-[(2S)-2-amino-2-carboxy-ethyl]sulfanyl-butanoic acid
IUPAC traditional: IUPAC cas(2S)-2-amino-4-[(2S)-2-amino-2-carboxy-ethyl]thio-butanoic acid
PubChem Substance (SID):
111677716 5347PubChem Compound (CID):
439698KEGG: Compound ID
C02291CAS Registry IDs: 56-88-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 17482
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
