InCHi String:
InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1
isomeric SMILES: C(C[C@@H](C(=O)O)N)CNC(=O)N
canonical SMILES: C(CC(C(=O)O)N)CNC(=O)N
IUPAC(2S)-2-amino-5-(carbamoylamino)pentanoic acid
IUPAC traditional: IUPAC cas: IUPAC openeye(2S)-2-amino-5-ureido-pentanoic acid
IUPAC systematic(2S)-2-amino-5-(aminocarbonylamino)pentanoic acid
PubChem Substance (SID):
85164881 152965 3621PubChem Compound (CID):
9750KEGG: Compound ID
C00327CAS Registry IDs: 372-75-8
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 16349 EINECS 206-759-6
NSC 27425
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
