InCHi String:
InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3/t6-/m1/s1
isomeric SMILES: C[N+](C)(C)C[C@@H](CC(=O)[O-])O
canonical SMILES: C[N+](C)(C)CC(CC(=O)[O-])O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic(3R)-3-hydroxy-4-trimethylammonio-butanoate
PubChem Substance (SID):
85165027 154219 854194PubChem Compound (CID):
10917KEGG: Compound ID
C13951CAS Registry IDs: 541-15-1 7634-98-2
PDB Chemical Component
152Miscellaneous Databases and IDs:
EINECS 208-768-0
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.