InCHi String:
InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1
isomeric SMILES: C(C[C@@H](C(=O)O)N)CN=C(N)N
canonical SMILES: C(CC(C(=O)O)N)CN=C(N)N
IUPAC(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid
IUPAC traditional: IUPAC cas: IUPAC openeye(2S)-2-amino-5-guanidino-pentanoic acid
PubChem Substance (SID):
85164878 149262 3362PubChem Compound (CID):
6322KEGG: Compound ID
C00062CAS Registry IDs: 142-49-4 7004-12-8 74-79-3
PDB Chemical Component
ARG ARG_LFOHMiscellaneous Databases and IDs:
CHEBI 16467 Beilstein Handbook Reference 4-04-00-02648
CCRIS 3609
HSDB 1429
EINECS 200-811-1
NSC 206269
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.