InCHi String:
InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5+/m0/s1
isomeric SMILES: C1[C@@H]([C@@H]([C@H]([C@H](O1)O)O)O)O
canonical SMILES: C1C(C(C(C(O1)O)O)O)O
IUPAC(2S,3R,4S,5S)-oxane-2,3,4,5-tetrol
IUPAC traditional: IUPAC cas: IUPAC openeye(2S,3R,4S,5S)-tetrahydropyran-2,3,4,5-tetrol
PubChem Substance (SID):
111677734 5591PubChem Compound (CID):
439764KEGG: Compound ID
C02604CAS Registry IDs: n/a
PDB Chemical Component
ARA ARBMiscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.