InCHi String:
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1
isomeric SMILES: C[C@@H](C(=O)O)N
canonical SMILES: CC(C(=O)O)N
IUPAC(2S)-2-aminopropanoic acid
PubChem Substance (SID):
85164877 148776 3343PubChem Compound (CID):
5950KEGG: Compound ID
C00041CAS Registry IDs: 115967-49-2 170805-71-7 56-41-7 6898-94-8
PDB Chemical Component
ALA ALA_LFOH ALA_LFZWMiscellaneous Databases and IDs:
CHEBI 16977 NSC 206315
EINECS 200-273-8
HSDB 1801
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.