InCHi String:
InChI=1S/C8H9NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h1-4,7,10H,9H2,(H,11,12)/t7-/m0/s1
canonical SMILES: C1=CC(=CC=C1C(C(=O)O)N)O
isomeric SMILES: C1=CC(=CC=C1[C@@H](C(=O)O)N)O
PUBCHEM iupac NAME: PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME(2S)-2-amino-2-(4-hydroxyphenyl)acetic acid
PUBCHEM iupac SYSTEMATIC NAME(2S)-2-azanyl-2-(4-hydroxyphenyl)ethanoic acid
PubChem Substance (SID):
111677771 24879955 47206995PubChem Compound (CID):
36143KEGG: Compound ID
D05292CAS Registry IDs: 32462-30-9
PDB Chemical Component
D4PMiscellaneous Databases and IDs:
Sigma-Aldrich 56160_FLUKA
ChEBI CHEBI:31755 MMCD cq_08863
MDL MFCD00065932
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.