InCHi String:
InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H
canonical SMILES: C1=CC(=CC=C1O)O
IUPAC: IUPAC openeye: IUPAC cas: IUPAC systematicbenzene-1,4-diol
IUPAC traditionalhydroquinone
PubChem Substance (SID):
85165097 173290 3812PubChem Compound (CID):
785KEGG: Compound ID
C00530CAS Registry IDs: 8027-02-9 57534-13-1 123-31-9
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChemIDplus 000123319
EINECS 204-617-8
CCRIS 714
HSDB 577
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
