InCHi String:
InChI=1S/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12)
canonical and isomeric SMILES: C1=CC=C(C=C1)C(=O)NCC(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME2-(benzoylamino)acetic acid
PUBCHEM iupac CAS NAME2-[(oxo-phenylmethyl)amino]acetic acid
PUBCHEM iupac SYSTEMATIC NAME2-(phenylcarbonylamino)ethanoic acid
PubChem Substance (SID):
85165200 37385468 10524100PubChem Compound (CID):
464KEGG: Compound ID
C01586CAS Registry IDs: 583-10-8 532-93-4 21251-67-2 532-94-5 66407-11-2 140480-84-8 495-69-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 112003_ALDRICH
ChEBI CHEBI:18089 BioCyc CPD-425
ChemIDplus 000495692
ChemSpider 10658403
EINECS 207-806-3
NMRShiftDB 10008879
Beilstein Handbook Reference 4-09-00-00778
ChemDB 4263626
NIST Chemistry WebBook 2157861166
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.