InCHi String:
InChI=1/C27H32O11/c1-15(35-17(3)29)21-12-23(32-6)27(24(13-21)33-7)38-25(14-34-16(2)28)26(37-19(5)31)20-8-10-22(11-9-20)36-18(4)30/h8-13,15,25-26H,14H2,1-7H3
Canonical and Isomeric SMILES: CC(C1=CC(=C(C(=C1)OC)OC(COC(C)=O)C(C2=CC=C(C=C2)OC(C)=O)OC(C)=O)OC)OC(C)=O
Lignin abbreviationH-b-S
PubChem Substance (SID):
111678020PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 225
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.