InCHi String:
InChI=1/C16H18O4/c1-11-2-8-14(9-3-11)20-15(10-17)16(19)12-4-6-13(18)7-5-12/h2-9,15-19H,10H2,1H3
Canonical and Isomeric SMILES: CC1=CC=C(C=C1)OC(CO)C(C2=CC=C(C=C2)O)O
Lignin abbreviationH-b-H5e
PubChem Substance (SID):
111678035PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 268 270
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.