InCHi String:
InChI=1S/C8H18N2O4S/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14/h11H,1-8H2,(H,12,13,14)
isomeric and canonical SMILES: C1CN(CC[NH+]1CCO)CCS(=O)(=O)[O-]
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic2-[4-(2-hydroxyethyl)-2,3,5,6-tetrahydropyrazin-1-yl]ethanesulfonate
PubChem Substance (SID):
85165019 166367PubChem Compound (CID):
23830KEGG: Compound ID n/a
CAS Registry IDs: 7365-45-9 75277-39-3
PDB Chemical Component
EPEMiscellaneous Databases and IDs:
EINECS 230-907-9
Beilstein Handbook Reference 5-23-02-00379
NSC 166663
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.