InCHi String:
InChI=1/C22H24O7/c1-12-8-16-17(11-27-13(2)23)21(29-22(16)20(9-12)26-5)15-6-7-18(28-14(3)24)19(10-15)25-4/h6-10,17,21H,11H2,1-5H3
Canonical and Isomeric SMILES: CC1=CC3=C(C(=C1)OC)OC(C2=CC(=C(C=C2)OC(C)=O)OC)C3COC(C)=O
Lignin abbreviationG-c-G
PubChem Substance (SID):
111678027PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 234
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.