InCHi String:
InChI=1/C9H10O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6,10H,2H2,1H3
Canonical SMILES: CCOC(C1=CC=C(C=C1)O)=O
Isomeric SMILES: CCOC(C1=CC=C(C=C1)O)=Os
BeilsteinEthyl 4-hydroxybenzoate
PubChem Substance (SID):
111678073PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 94
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
