InCHi String:
InChI=1/C18H18O8/c1-23-13-7-9(17(19)20)5-11(15(13)25-3)12-6-10(18(21)22)8-14(24-2)16(12)26-4/h5-8H,1-4H3,(H,19,20)(H,21,22)/f/h19,21H
Canonical and Isomeric SMILES: COC1=CC(=CC(=C1OC)C2=C(C(=CC(=C2)C(O)=O)OC)OC)C(O)=O
BeilsteinDehydrodiveratric acid
PubChem Substance (SID):
111678069PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 72
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
