InCHi String:
InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)
isomeric and canonical SMILES: C(C(C(C(C(=O)O)O)O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic2,3,4,5-tetrahydroxypentanoic acid
PubChem Substance (SID):
85164989 3785PubChem Compound (CID):
10264 5460056KEGG: Compound ID
C00502CAS Registry IDs: 526-91-0
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 17746
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
