InCHi String:
InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2?,3-,4+,5+,6-,7?
canonical SMILES: COC1C(C(C(C(C1O)O)O)O)O
isomeric SMILES: COC1[C@@H]([C@H](C([C@H]([C@@H]1O)O)O)O)O
PUBCHEM iupac NAME: PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME: PUBCHEM iupac SYSTEMATIC NAME(1S,2R,4S,5R)-6-methoxycyclohexane-1,2,3,4,5-pentol
PubChem Substance (SID):
111677871 6202 87288707PubChem Compound (CID):
439990KEGG: Compound ID
C06353CAS Registry IDs: 523-92-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChEBI CHEBI:588262 ZINC ZINC18268580
MMCD cq_02266
CAS 10284-63-6
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
