InCHi String:
InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m1/s1
isomeric SMILES: C(C[C@H](C(=O)O)N)CN
canonical SMILES: C(CC(C(=O)O)N)CN
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic(2R)-2,5-diaminopentanoic acid
PubChem Substance (SID):
85164871 213263 3798PubChem Compound (CID):
71082KEGG: Compound ID
C00515CAS Registry IDs: 348-66-3
PDB Chemical Component
ORDMiscellaneous Databases and IDs:
CHEBI 16176 EINECS 206-482-0
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
