InCHi String:
InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m1/s1
isomeric SMILES: C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O)O
canonical SMILES: C(C1C(C(C(C(O1)O)O)O)O)O
IUPAC(2S,3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol
IUPAC traditional(2S,3R,4S,5R,6R)-6-methyloltetrahydropyran-2,3,4,5-tetrol
IUPAC cas: IUPAC openeye(2S,3R,4S,5R,6R)-6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetrol
PubChem Substance (SID):
85164867 656040 3565PubChem Compound (CID):
79025 107526KEGG: Compound ID
C00267CAS Registry IDs: 492-62-6
PDB Chemical Component
AGC GLCMiscellaneous Databases and IDs:
CHEBI 17925 EINECS 207-757-8
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.