InCHi String:
InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)
isomeric and canonical SMILES: C(CC(C(=O)O)N)CNC(=O)N
IUPAC2-amino-5-(carbamoylamino)pentanoic acid
IUPAC traditional: IUPAC cas: IUPAC openeye2-amino-5-ureido-pentanoic acid
IUPAC systematic2-amino-5-(aminocarbonylamino)pentanoic acid
PubChem Substance (SID):
85165025 254119PubChem Compound (CID):
833KEGG: Compound ID n/a
CAS Registry IDs: 13594-51-9
PDB Chemical Component
CIRMiscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.